CAS 284474-52-8 appears in our catalog under these names: 4-hydroxybenzaldehyde-2,3,5,6-d4, 4-Hydroxybenzaldehyde-d4, 4-Hydroxybenzaldehyde-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, p–Hydroxybenzaldehyde–d4, p-Hydroxybenzaldehyde-d4, 99.65%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 100mg, 250mg, 25mg, 0,25g, 0,1g, 10mg, 5mg.
2,3,5,6-tetradeuterio-4-hydroxybenzaldehyde (CAS 284474-52-8) is a chemical compound with the molecular formula C7H6O2 and a molecular weight of 126.15 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-hydroxybenzaldehyde. InChIKey: RGHHSNMVTDWUBI-RHQRLBAQSA-N.
| Molecular formula | C7H6O2 |
|---|---|
| Molecular weight | 126.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-hydroxybenzaldehyde |
| InChIKey | RGHHSNMVTDWUBI-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)