Products 1079-02-3
CAS 1079-02-3 appears in our catalog under these names: Benzoic acid-d5, 95%, Benzoic Acid-d5, >95% (HPLC), Benzoic acid D5 (phenyl D5), Benzoic-d5 Acid, 99 atom % D, min 98% Chemical Purity, Benzoic acid–2,3,4,5,6–d5. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: 1g, 100mg, 10mg, 5g, 1x500mg, 100 mg, 50 mg.
2,3,4,5,6-pentadeuteriobenzoic acid (CAS 1079-02-3) is a chemical compound with the molecular formula C7H6O2 and a molecular weight of 127.15 g/mol. IUPAC name: 2,3,4,5,6-pentadeuteriobenzoic acid. InChIKey: WPYMKLBDIGXBTP-RALIUCGRSA-N.
| Molecular formula | C7H6O2 |
|---|---|
| Molecular weight | 127.15 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuteriobenzoic acid |
| InChIKey | WPYMKLBDIGXBTP-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)