CAS 222412-89-7 appears in our catalog under these names: Benzoic-13C7 acid, 98%, BENZOIC ACID-13C7, 99 ATOM % 13C. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
(1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid (CAS 222412-89-7) is a chemical compound with the molecular formula C7H6O2 and a molecular weight of 129.070 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid. InChIKey: WPYMKLBDIGXBTP-BNUYUSEDSA-N.
| Molecular formula | C7H6O2 |
|---|---|
| Molecular weight | 129.070 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid |
| InChIKey | WPYMKLBDIGXBTP-BNUYUSEDSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)[13C](=O)O |
Computed by PubChem (NCBI)