CAS 2845089-06-5 is the registry number for Methyl (R)-2-(3,6-dimethyl-2,3-dihydrobenzofuran-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(3R)-3,6-dimethyl-2H-1-benzofuran-3-yl]acetate (CAS 2845089-06-5) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl 2-[(3R)-3,6-dimethyl-2H-1-benzofuran-3-yl]acetate. InChIKey: PWKWKKFUUFRBPX-ZDUSSCGKSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl 2-[(3R)-3,6-dimethyl-2H-1-benzofuran-3-yl]acetate |
| InChIKey | PWKWKKFUUFRBPX-ZDUSSCGKSA-N |
| SMILES | CC1=CC2=C(C=C1)[C@@](CO2)(C)CC(=O)OC |
Computed by PubChem (NCBI)