Products 2845120-28-5
CAS 2845120-28-5 is the registry number for (5S)-2-(2-Bromophenyl)-3,5-dimethylimidazolidin-4-one, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(5S)-2-(2-bromophenyl)-3,5-dimethylimidazolidin-4-one (CAS 2845120-28-5) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: (5S)-2-(2-bromophenyl)-3,5-dimethylimidazolidin-4-one. InChIKey: MLDLVBNQMSUEPS-BYDSUWOYSA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | (5S)-2-(2-bromophenyl)-3,5-dimethylimidazolidin-4-one |
| InChIKey | MLDLVBNQMSUEPS-BYDSUWOYSA-N |
| SMILES | C[C@H]1C(=O)N(C(N1)C2=CC=CC=C2Br)C |
Computed by PubChem (NCBI)