CAS 2845126-17-0 is the registry number for 2-(5-Oxazolyl)benzylamine Hydrochloride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[2-(1,3-oxazol-5-yl)phenyl]methanamine;hydrochloride (CAS 2845126-17-0) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: [2-(1,3-oxazol-5-yl)phenyl]methanamine;hydrochloride. InChIKey: UETRIVVIIBJCNY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | [2-(1,3-oxazol-5-yl)phenyl]methanamine;hydrochloride |
| InChIKey | UETRIVVIIBJCNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)C2=CN=CO2.Cl |
Computed by PubChem (NCBI)