Products 284665-22-1
CAS 284665-22-1 appears in our catalog under these names: 1,4-Butane-d8-diamine Dihydrochloride, >95% (HPLC), 1,4-Butane-d8-diamine 2HCl, 98 atom % D, min 98% Chemical Purity, 1,4–Diaminobutane–d8 dihydrochloride. Offered by: TRC, CDN, GLPBio. Available pack sizes: 100mg, 25mg, 50mg, 0,5g, 0,25g, 10mg, 5mg.
1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diamine;dihydrochloride (CAS 284665-22-1) is a chemical compound with the molecular formula C4H14Cl2N2 and a molecular weight of 169.12 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diamine;dihydrochloride. InChIKey: XXWCODXIQWIHQN-VHGLFXLXSA-N.
| Molecular formula | C4H14Cl2N2 |
|---|---|
| Molecular weight | 169.12 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diamine;dihydrochloride |
| InChIKey | XXWCODXIQWIHQN-VHGLFXLXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])N)C([2H])([2H])N.Cl.Cl |
Computed by PubChem (NCBI)