Products 88972-24-1
CAS 88972-24-1 appears in our catalog under these names: 1,4-Butane-2,2,3,3-d4-diamine 2HCl, >95% (HPLC), 1,4-Butane-2,2,3,3-d4-diamine 2HCl, 98 atom % D, min 98% Chemical Purity, 1,4-DIAMINOBUTANE-2,2,3,3-D4 DIHYDRO-. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 500MG.
2,2,3,3-tetradeuteriobutane-1,4-diamine;dihydrochloride (CAS 88972-24-1) is a chemical compound with the molecular formula C4H14Cl2N2 and a molecular weight of 165.10 g/mol. IUPAC name: 2,2,3,3-tetradeuteriobutane-1,4-diamine;dihydrochloride. InChIKey: XXWCODXIQWIHQN-RIZDZYNXSA-N.
| Molecular formula | C4H14Cl2N2 |
|---|---|
| Molecular weight | 165.10 g/mol |
| IUPAC name | 2,2,3,3-tetradeuteriobutane-1,4-diamine;dihydrochloride |
| InChIKey | XXWCODXIQWIHQN-RIZDZYNXSA-N |
| SMILES | [2H]C([2H])(CN)C([2H])([2H])CN.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Putrescine-2,2,3,3-d4 dihydrochloride, 2,2,3,3-Tetradeuteriobutane-1,4-diamine;dihydrochloride, 1,4-Butanediamine-2,2,3,3-d4 dihydrochloride, 1,4-Diaminobutane-2,2,3,3-d4 dihydrochloride, 1,4-Diaminobutane-2,2,3,3-d? dihydrochloride, 1,4-Diaminobutane-2,2,3,3-d4 dihydrochloride, 98 atom % D, (2,2,3,3-~2~H_4_)Butane-1,4-diamine--hydrogen chloride (1/2)