CAS 96839-26-8 is the registry number for 1,4-Diaminobutane-1,4-13C2 Dihydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
(1,4-13C2)butane-1,4-diamine;dihydrochloride (CAS 96839-26-8) is a chemical compound with the molecular formula C4H14Cl2N2 and a molecular weight of 163.06 g/mol. IUPAC name: (1,4-13C2)butane-1,4-diamine;dihydrochloride. InChIKey: XXWCODXIQWIHQN-MWLKZMJOSA-N.
| Molecular formula | C4H14Cl2N2 |
|---|---|
| Molecular weight | 163.06 g/mol |
| IUPAC name | (1,4-13C2)butane-1,4-diamine;dihydrochloride |
| InChIKey | XXWCODXIQWIHQN-MWLKZMJOSA-N |
| SMILES | C(C[13CH2]N)[13CH2]N.Cl.Cl |
Computed by PubChem (NCBI)