CAS 28480-70-8 appears in our catalog under these names: 5'-Chloro-2'-hydroxy-4'-methylacetophenone, 98%, 5'–Chloro–2'–hydroxy–4'–methylacetophenone, 5'-Chloro-2'-hydroxy-4'-methylacetophenone, >95.0%(GC), 1-(5-Chloro-2-hydroxy-4-methylphenyl)ethanone 98%, 1-(5-Chloro-2-hydroxy-4-methylphenyl)ethanone, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 10g.
1-(5-chloro-2-hydroxy-4-methylphenyl)ethanone (CAS 28480-70-8) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 1-(5-chloro-2-hydroxy-4-methylphenyl)ethanone. InChIKey: HDUSGGZSLVCDKY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1-(5-chloro-2-hydroxy-4-methylphenyl)ethanone |
| InChIKey | HDUSGGZSLVCDKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C(=O)C)O |
Computed by PubChem (NCBI)