CAS 28491-95-4 is the registry number for N-Ethyl 4-chloro-2-nitroaniline. Offered by: Fluorochem. Available pack sizes: 25g.
4-chloro-N-ethyl-2-nitroaniline (CAS 28491-95-4) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 4-chloro-N-ethyl-2-nitroaniline. InChIKey: PVIUZYZWJNQCIR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 4-chloro-N-ethyl-2-nitroaniline |
| InChIKey | PVIUZYZWJNQCIR-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)