Products 2852765-75-2
CAS 2852765-75-2 is the registry number for tert-Butyl (1S,5R)-1-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S,5R)-1-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2852765-75-2) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (1S,5R)-1-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: ZUSMRVOGWJYRSQ-SKDRFNHKSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (1S,5R)-1-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | ZUSMRVOGWJYRSQ-SKDRFNHKSA-N |
| SMILES | C[C@@]12CC[C@@H](N1C(=O)OC(C)(C)C)CNC2 |
Computed by PubChem (NCBI)