Products 2852766-02-8
CAS 2852766-02-8 is the registry number for tert-Butyl (1R,5S)-1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5S)-1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2852766-02-8) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (1R,5S)-1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: SIHJIQSUJRMADR-JOYOIKCWSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (1R,5S)-1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | SIHJIQSUJRMADR-JOYOIKCWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@]1(CNC2)CO |
Computed by PubChem (NCBI)