CAS 2855060-74-9 is the registry number for 3-Cyclopropyl-7-(hydroxymethyl)-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-7-(hydroxymethyl)-1H-1,5-naphthyridin-2-one (CAS 2855060-74-9) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3-cyclopropyl-7-(hydroxymethyl)-1H-1,5-naphthyridin-2-one. InChIKey: IIZXOPLSCCQJRV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3-cyclopropyl-7-(hydroxymethyl)-1H-1,5-naphthyridin-2-one |
| InChIKey | IIZXOPLSCCQJRV-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(C=C(C=N3)CO)NC2=O |
Computed by PubChem (NCBI)