Products 28568-04-9
CAS 28568-04-9 appears in our catalog under these names: 2-Amino-4,5-dichlorobenzonitrile 97%, 2-Amino-4,5-dichlorobenzonitrile, 97%, 97%, 2-Amino-4,5-dichlorobenzonitrile, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-amino-4,5-dichlorobenzonitrile (CAS 28568-04-9) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2-amino-4,5-dichlorobenzonitrile. InChIKey: OERKZOSLSXFLMY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2-amino-4,5-dichlorobenzonitrile |
| InChIKey | OERKZOSLSXFLMY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)N)C#N |
Computed by PubChem (NCBI)