Products 285977-88-0
CAS 285977-88-0 is the registry number for L-Leucine-2-13C,15N, 98.0%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 100 mg, 25 mg, 50 mg, 10 mg.
(2S)-2-(15N)azanyl-4-methyl(213C)pentanoic acid (CAS 285977-88-0) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 133.16 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-methyl(213C)pentanoic acid. InChIKey: ROHFNLRQFUQHCH-VZRCWKLKSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 133.16 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-methyl(213C)pentanoic acid |
| InChIKey | ROHFNLRQFUQHCH-VZRCWKLKSA-N |
| SMILES | CC(C)C[13C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)