Products 2865185-31-3
CAS 2865185-31-3 is the registry number for 25N-N1-Nap. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,5-dimethoxy-4-nitrophenyl)-N-(naphthalen-1-ylmethyl)ethanamine (CAS 2865185-31-3) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 2-(2,5-dimethoxy-4-nitrophenyl)-N-(naphthalen-1-ylmethyl)ethanamine. InChIKey: ALVHBRTUOXXMDK-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-(2,5-dimethoxy-4-nitrophenyl)-N-(naphthalen-1-ylmethyl)ethanamine |
| InChIKey | ALVHBRTUOXXMDK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1CCNCC2=CC=CC3=CC=CC=C32)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
25N-N1-Nap, orb2567258