CAS 28664-62-2 appears in our catalog under these names: 2-Phenoxypyridin-3-amine, 2-Phenoxypyridin-3-amine, 95%, 2-Phenoxypyridin-3-amine 95%. Offered by: Biosynth, Combi-blocks, Ambeed. Available pack sizes: 0,5g, 5g, 1g, 100mg, 250mg.
2-phenoxypyridin-3-amine (CAS 28664-62-2) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenoxypyridin-3-amine. InChIKey: GITFEFNVRNPOHX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenoxypyridin-3-amine |
| InChIKey | GITFEFNVRNPOHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=CC=N2)N |
Computed by PubChem (NCBI)