Products 2869178-66-3
CAS 2869178-66-3 is the registry number for 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentan-1-ol (CAS 2869178-66-3) is a chemical compound with the molecular formula C17H25BO3 and a molecular weight of 288.2 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentan-1-ol. InChIKey: JGCGSISWBKVFDK-UHFFFAOYSA-N.
| Molecular formula | C17H25BO3 |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentan-1-ol |
| InChIKey | JGCGSISWBKVFDK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CCCC3)O |
Computed by PubChem (NCBI)