Products 2869808-20-6
CAS 2869808-20-6 is the registry number for 8-Bromo-3,3-dimethyl-3,4-dihydrobenzo[f][1,4]oxazepin-5(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-3,3-dimethyl-2,4-dihydro-1,4-benzoxazepin-5-one (CAS 2869808-20-6) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 8-bromo-3,3-dimethyl-2,4-dihydro-1,4-benzoxazepin-5-one. InChIKey: NDMPUIAOMZVHRV-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 8-bromo-3,3-dimethyl-2,4-dihydro-1,4-benzoxazepin-5-one |
| InChIKey | NDMPUIAOMZVHRV-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(C=CC(=C2)Br)C(=O)N1)C |
Computed by PubChem (NCBI)