Products 2869955-57-5

CAS 2869955-57-5 is the registry number for 3-(Benzyloxy)-4-fluoro-5-methylpicolinic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-5-methyl-3-phenylmethoxypyridine-2-carboxylic acid (CAS 2869955-57-5) is a chemical compound with the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. IUPAC name: 4-fluoro-5-methyl-3-phenylmethoxypyridine-2-carboxylic acid. InChIKey: ZKEYRTAGABFSPV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12FNO3
Molecular weight261.25 g/mol
IUPAC name4-fluoro-5-methyl-3-phenylmethoxypyridine-2-carboxylic acid
InChIKeyZKEYRTAGABFSPV-UHFFFAOYSA-N
SMILESCC1=CN=C(C(=C1F)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)