Products 287100-64-5
CAS 287100-64-5 appears in our catalog under these names: Alpha-D-glucose-13C, 99.4%, D-glucose-3-13C, 99 atom % 13C, 99% (CP, D-Glucose-3-¹³C, ≥99 atom% 13C,≥98%. Offered by: MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 10 mg, 25 mg, 50 mg, 100 mg, 5 mg, 100MG, 1G, 25mg.
(2S,3R,4S,5S,6R)-6-(hydroxymethyl)(413C)oxane-2,3,4,5-tetrol (CAS 287100-64-5) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-6-(hydroxymethyl)(413C)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-KTESCNBYSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)(413C)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-KTESCNBYSA-N |
| SMILES | C([C@@H]1[C@H]([13C@@H]([C@H]([C@H](O1)O)O)O)O)O |
Computed by PubChem (NCBI)