Products 287100-74-7
CAS 287100-74-7 appears in our catalog under these names: D-Mannose-UL-13C6, >95% (HPLC), D–Mannose–13C6, D-(UL-¹³C6)mannose, D-Mannose-13C6, 98%, 98%, D-Mannose-13C6, 98.0%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 10 mg.
(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanal (CAS 287100-74-7) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 186.11 g/mol. IUPAC name: (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanal. InChIKey: GZCGUPFRVQAUEE-CRWJSTOYSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanal |
| InChIKey | GZCGUPFRVQAUEE-CRWJSTOYSA-N |
| SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C@@H]([13CH]=O)O)O)O)O)O |
Computed by PubChem (NCBI)