CAS 287198-03-2 is the registry number for 2-Chloro-n-(3,5-di-tert-butylphenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-chloro-N-(3,5-ditert-butylphenyl)acetamide (CAS 287198-03-2) is a chemical compound with the molecular formula C16H24ClNO and a molecular weight of 281.82 g/mol. IUPAC name: 2-chloro-N-(3,5-ditert-butylphenyl)acetamide. InChIKey: QNZGCCXVITZXHL-UHFFFAOYSA-N.
| Molecular formula | C16H24ClNO |
|---|---|
| Molecular weight | 281.82 g/mol |
| IUPAC name | 2-chloro-N-(3,5-ditert-butylphenyl)acetamide |
| InChIKey | QNZGCCXVITZXHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)NC(=O)CCl)C(C)(C)C |
Computed by PubChem (NCBI)