CAS 66170-31-8 appears in our catalog under these names: Tramadol Hydrochloride EP Impurity C HCl, Tramadol EP Impurity C HCl, Tramadol Impurity 3(Tramadol EP Impurity C), 1,6-Dehydro Tramadol Hydrochloride, >95% (HPLC), (1RS)-(2-(3-Methoxyphenyl)cyclohex-2-enyl)-N,N-dimethylmethanamine Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, LoGiCal. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
1-[2-(3-methoxyphenyl)cyclohex-2-en-1-yl]-N,N-dimethylmethanamine;hydrochloride (CAS 66170-31-8) is a chemical compound with the molecular formula C16H24ClNO and a molecular weight of 281.82 g/mol. IUPAC name: 1-[2-(3-methoxyphenyl)cyclohex-2-en-1-yl]-N,N-dimethylmethanamine;hydrochloride. InChIKey: KTYGAWYKBWMJNI-UHFFFAOYSA-N.
| Molecular formula | C16H24ClNO |
|---|---|
| Molecular weight | 281.82 g/mol |
| IUPAC name | 1-[2-(3-methoxyphenyl)cyclohex-2-en-1-yl]-N,N-dimethylmethanamine;hydrochloride |
| InChIKey | KTYGAWYKBWMJNI-UHFFFAOYSA-N |
| SMILES | CN(C)CC1CCCC=C1C2=CC(=CC=C2)OC.Cl |
Computed by PubChem (NCBI)