Products 91625-74-0
CAS 91625-74-0 appears in our catalog under these names: Tolperisone Impurity B, 3-Tolperisone HCl, Tolperisone Impurity 2, 3-Tolperisone Hydrochloride, >95% (HPLC), 3-Tolperisone hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
2-methyl-1-(3-methylphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride (CAS 91625-74-0) is a chemical compound with the molecular formula C16H24ClNO and a molecular weight of 281.82 g/mol. IUPAC name: 2-methyl-1-(3-methylphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride. InChIKey: VBFUKHZWQBJGPV-UHFFFAOYSA-N.
| Molecular formula | C16H24ClNO |
|---|---|
| Molecular weight | 281.82 g/mol |
| IUPAC name | 2-methyl-1-(3-methylphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride |
| InChIKey | VBFUKHZWQBJGPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)C(C)CN2CCCCC2.Cl |
Computed by PubChem (NCBI)