CAS 287210-80-4 appears in our catalog under these names: N-Boc-(r)-2-(methylamino)butyric acid, 95%, (R)–2–((tert–Butoxycarbonyl)(methyl)amino)butanoic acid, Boc-N-Me-D-Abu-OH 95%, (R)-2-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid, 97%, 97%, (R)-2-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg.
(2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 287210-80-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: QIXDRLIEARGEQY-SSDOTTSWSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | QIXDRLIEARGEQY-SSDOTTSWSA-N |
| SMILES | CC[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)