Products 52939-12-5
CAS 52939-12-5 appears in our catalog under these names: Oxypeucedanin methanolate, (+)-Oxypeucedanin methanolate, ≥98%, ≥98%, (+)-Oxypeucedanin methanolate. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 20mg, 1 mg, 5 mg.
4-[(2R)-2-hydroxy-3-methoxy-3-methylbutoxy]furo[3,2-g]chromen-7-one (CAS 52939-12-5) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: 4-[(2R)-2-hydroxy-3-methoxy-3-methylbutoxy]furo[3,2-g]chromen-7-one. InChIKey: UHENVVIVPZCJOA-CQSZACIVSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | 4-[(2R)-2-hydroxy-3-methoxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| InChIKey | UHENVVIVPZCJOA-CQSZACIVSA-N |
| SMILES | CC(C)([C@@H](COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)O)OC |
Computed by PubChem (NCBI)