CAS 2873410-71-8 is the registry number for Dimethyl 2-(2-oxo-2,3-dihydrobenzo[d]oxazol-6-yl)bicyclo[1.1.1]pentane-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2-(2-oxo-3H-1,3-benzoxazol-6-yl)bicyclo[1.1.1]pentane-1,3-dicarboxylate (CAS 2873410-71-8) is a chemical compound with the molecular formula C16H15NO6 and a molecular weight of 317.29 g/mol. IUPAC name: dimethyl 2-(2-oxo-3H-1,3-benzoxazol-6-yl)bicyclo[1.1.1]pentane-1,3-dicarboxylate. InChIKey: PTIMNABRKVVLNZ-UHFFFAOYSA-N.
| Molecular formula | C16H15NO6 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | dimethyl 2-(2-oxo-3H-1,3-benzoxazol-6-yl)bicyclo[1.1.1]pentane-1,3-dicarboxylate |
| InChIKey | PTIMNABRKVVLNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2C3=CC4=C(C=C3)NC(=O)O4)C(=O)OC |
Computed by PubChem (NCBI)