Products 1820716-99-1
CAS 1820716-99-1 is the registry number for methyl 4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoate (CAS 1820716-99-1) is a chemical compound with the molecular formula C16H15NO6 and a molecular weight of 317.29 g/mol. IUPAC name: methyl 4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoate. InChIKey: JYPIXYODZRQUIS-UHFFFAOYSA-N.
| Molecular formula | C16H15NO6 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | methyl 4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoate |
| InChIKey | JYPIXYODZRQUIS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(C(=CC(=C2)C(=O)OC)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)