CAS 926264-77-9 appears in our catalog under these names: 5-[(3,5-Dimethoxybenzoyl)amino]-2-hydroxybenzoic acid, 95%, 5-(3,5-Dimethoxybenzamido)-2-hydroxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid (CAS 926264-77-9) is a chemical compound with the molecular formula C16H15NO6 and a molecular weight of 317.29 g/mol. IUPAC name: 5-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: VHQWYZLUFWOMBU-UHFFFAOYSA-N.
| Molecular formula | C16H15NO6 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | 5-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid |
| InChIKey | VHQWYZLUFWOMBU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)NC2=CC(=C(C=C2)O)C(=O)O)OC |
Computed by PubChem (NCBI)