CAS 1030572-38-3 appears in our catalog under these names: 4-(3,4-Dimethoxybenzamido)-2-hydroxybenzoic acid, 95%, 4-(3,4-Dimethoxybenzamido)-2-hydroxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[(3,4-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid (CAS 1030572-38-3) is a chemical compound with the molecular formula C16H15NO6 and a molecular weight of 317.29 g/mol. IUPAC name: 4-[(3,4-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: YMKNDWXEVQAMDG-UHFFFAOYSA-N.
| Molecular formula | C16H15NO6 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | 4-[(3,4-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid |
| InChIKey | YMKNDWXEVQAMDG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NC2=CC(=C(C=C2)C(=O)O)O)OC |
Computed by PubChem (NCBI)