Products 287484-32-6
CAS 287484-32-6 appears in our catalog under these names: L–Asparagine–15N2 monohydrate, L-ASPARAGINE-15N2 MONOHYDRATE, 98 ATOM&, L-Asparagine-15N2 (monohydrate), 98%, 98%, L-Asparagine-15N2 (monohydrate), 99.0%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 250MG, 50 mg, 10 mg, 5 mg, 25 mg.
(2S)-2,4-bis(15N)(azanyl)-4-oxobutanoic acid;hydrate (CAS 287484-32-6) is a chemical compound with the molecular formula C4H10N2O4 and a molecular weight of 152.12 g/mol. IUPAC name: (2S)-2,4-bis(15N)(azanyl)-4-oxobutanoic acid;hydrate. InChIKey: RBMGJIZCEWRQES-SQHSRYIDSA-N.
| Molecular formula | C4H10N2O4 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | (2S)-2,4-bis(15N)(azanyl)-4-oxobutanoic acid;hydrate |
| InChIKey | RBMGJIZCEWRQES-SQHSRYIDSA-N |
| SMILES | C([C@@H](C(=O)O)[15NH2])C(=O)[15NH2].O |
Computed by PubChem (NCBI)