Products 288159-36-4
CAS 288159-36-4 is the registry number for tert-Butyl (R)-4-(2-hydroxypropan-2-yl)-2,2-dimethyloxazolidine-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (4R)-4-(2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 288159-36-4) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: tert-butyl (4R)-4-(2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: WRMSCAJFEZKYCB-SECBINFHSA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | tert-butyl (4R)-4-(2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | WRMSCAJFEZKYCB-SECBINFHSA-N |
| SMILES | CC1(N([C@H](CO1)C(C)(C)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)