CAS 288251-63-8 appears in our catalog under these names: 1-(4-Fluorophenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 288251-63-8) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: NKCDCNWWMFTZPW-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2 |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | NKCDCNWWMFTZPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)F)C)C(=O)O |
Computed by PubChem (NCBI)