CAS 288252-08-4 appears in our catalog under these names: 5-Amino-2-(2,2,2-trifluoroethoxy)benzonitrile, 95%, 5-Amino-2-(2,2,2-trifluoroethoxy)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-amino-2-(2,2,2-trifluoroethoxy)benzonitrile (CAS 288252-08-4) is a chemical compound with the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. IUPAC name: 5-amino-2-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: VGDCFDPLGVICBG-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 5-amino-2-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | VGDCFDPLGVICBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C#N)OCC(F)(F)F |
Computed by PubChem (NCBI)