CAS 2883019-47-2 is the registry number for (S)-(7-Fluoro-3,4-dihydro-2H-benzo[b][1,4]oxazin-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S)-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol (CAS 2883019-47-2) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: [(3S)-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol. InChIKey: OZBVEQRBCNXKHK-ZETCQYMHSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | [(3S)-7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl]methanol |
| InChIKey | OZBVEQRBCNXKHK-ZETCQYMHSA-N |
| SMILES | C1[C@@H](NC2=C(O1)C=C(C=C2)F)CO |
Computed by PubChem (NCBI)