CAS 288384-55-4 appears in our catalog under these names: 3-Fluoroquinolin-7-ol, 95%, 3–Fluoroquinolin–7–ol, 3-Fluoroquinolin-7-ol, 97%, 97%, 3-FLUOROQUINOLIN-7-OL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-fluoroquinolin-7-ol (CAS 288384-55-4) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 3-fluoroquinolin-7-ol. InChIKey: PWYWRUGPXKKQEE-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 3-fluoroquinolin-7-ol |
| InChIKey | PWYWRUGPXKKQEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)F)O |
Computed by PubChem (NCBI)