CAS 288571-29-9 is the registry number for 2-Methoxy-1-(2,4,6-trimethylphenyl)-ethanone. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methoxy-1-(2,4,6-trimethylphenyl)ethanone (CAS 288571-29-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-methoxy-1-(2,4,6-trimethylphenyl)ethanone. InChIKey: BPCKAYGFVGQERV-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2-methoxy-1-(2,4,6-trimethylphenyl)ethanone |
| InChIKey | BPCKAYGFVGQERV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)COC)C |
Computed by PubChem (NCBI)