CAS 28900-64-3 appears in our catalog under these names: 2,3-Dihydroxy-L-Phenylalanine, Levodopa Impurity 12. Offered by: Creative Peptides, Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid (CAS 28900-64-3) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: (2S)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid. InChIKey: NATUQRGCLABGAL-LURJTMIESA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid |
| InChIKey | NATUQRGCLABGAL-LURJTMIESA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)