CAS 339186-39-9 is the registry number for Levodopa Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid (CAS 339186-39-9) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: (2R)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid. InChIKey: NATUQRGCLABGAL-ZCFIWIBFSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid |
| InChIKey | NATUQRGCLABGAL-ZCFIWIBFSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)