Products 339186-39-9

CAS 339186-39-9 is the registry number for Levodopa Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid (CAS 339186-39-9) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: (2R)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid. InChIKey: NATUQRGCLABGAL-ZCFIWIBFSA-N.

Identity
Molecular formulaC9H11NO4
Molecular weight197.19 g/mol
IUPAC name(2R)-2-amino-3-(2,3-dihydroxyphenyl)propanoic acid
InChIKeyNATUQRGCLABGAL-ZCFIWIBFSA-N
SMILESC1=CC(=C(C(=C1)O)O)C[C@H](C(=O)O)N

Computed by PubChem (NCBI)