Products 2891597-12-7

CAS 2891597-12-7 is the registry number for Methyl 5-((benzyloxy)methyl)piperidine-2-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 5-(phenylmethoxymethyl)piperidine-2-carboxylate;hydrochloride (CAS 2891597-12-7) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: methyl 5-(phenylmethoxymethyl)piperidine-2-carboxylate;hydrochloride. InChIKey: SXAHSYHEOWUTPU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO3
Molecular weight299.79 g/mol
IUPAC namemethyl 5-(phenylmethoxymethyl)piperidine-2-carboxylate;hydrochloride
InChIKeySXAHSYHEOWUTPU-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(CN1)COCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)