Products 2891599-77-0
CAS 2891599-77-0 is the registry number for ethyl 1-(difluoromethyl)-5-methyl-pyrazole-4-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl 1-(difluoromethyl)-5-methylpyrazole-4-carboxylate (CAS 2891599-77-0) is a chemical compound with the molecular formula C8H10F2N2O2 and a molecular weight of 204.17 g/mol. IUPAC name: ethyl 1-(difluoromethyl)-5-methylpyrazole-4-carboxylate. InChIKey: RTYHUMLKRMFHKX-UHFFFAOYSA-N.
| Molecular formula | C8H10F2N2O2 |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | ethyl 1-(difluoromethyl)-5-methylpyrazole-4-carboxylate |
| InChIKey | RTYHUMLKRMFHKX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C(F)F)C |
Computed by PubChem (NCBI)