CAS 2892-16-2 appears in our catalog under these names: 5'-Chloro-2'-hydroxypropiophenone, 5'-Chloro-2'-hydroxypropiophenone, 95%, 1–(5–Chloro–2–hydroxyphenyl)propan–1–one, 1-(5-Chloro-2-hydroxyphenyl)propan-1-one, >97%, >97%. Offered by: Biosynth, Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg, 10g.
1-(5-chloro-2-hydroxyphenyl)propan-1-one (CAS 2892-16-2) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 1-(5-chloro-2-hydroxyphenyl)propan-1-one. InChIKey: IVNYWGRYCXKHDW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1-(5-chloro-2-hydroxyphenyl)propan-1-one |
| InChIKey | IVNYWGRYCXKHDW-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)