CAS 2892250-02-9 is the registry number for rel-(1R,2S,3S)-3-(Benzyloxy)-2-methylcyclobutan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,3S)-2-methyl-3-phenylmethoxycyclobutan-1-ol (CAS 2892250-02-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: (1R,2S,3S)-2-methyl-3-phenylmethoxycyclobutan-1-ol. InChIKey: MPMQCMBHCZYAGE-WCQGTBRESA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | (1R,2S,3S)-2-methyl-3-phenylmethoxycyclobutan-1-ol |
| InChIKey | MPMQCMBHCZYAGE-WCQGTBRESA-N |
| SMILES | C[C@H]1[C@@H](C[C@@H]1OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)