Products 2892290-44-5
CAS 2892290-44-5 is the registry number for Methyl (S)-2-((tert-butoxycarbonyl)amino)-3,3-dimethylpent-4-ynoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate (CAS 2892290-44-5) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate. InChIKey: KSMCNEQNZDBKCL-SECBINFHSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate |
| InChIKey | KSMCNEQNZDBKCL-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)OC)C(C)(C)C#C |
Computed by PubChem (NCBI)