Products 2892730-51-5
CAS 2892730-51-5 is the registry number for 3-(6-(Aminomethyl)benzo[d]isoxazol-3-yl)piperidine-2,6-dione hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride (CAS 2892730-51-5) is a chemical compound with the molecular formula C13H14ClN3O3 and a molecular weight of 295.72 g/mol. IUPAC name: 3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride. InChIKey: SCMRXCPPEJDJIK-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O3 |
|---|---|
| Molecular weight | 295.72 g/mol |
| IUPAC name | 3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride |
| InChIKey | SCMRXCPPEJDJIK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C=CC(=C3)CN.Cl |
Computed by PubChem (NCBI)