CAS 923685-65-8 is the registry number for 2-Chloro-n-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (CAS 923685-65-8) is a chemical compound with the molecular formula C13H14ClN3O3 and a molecular weight of 295.72 g/mol. IUPAC name: 2-chloro-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide. InChIKey: ASCOLXHIXNBOGE-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O3 |
|---|---|
| Molecular weight | 295.72 g/mol |
| IUPAC name | 2-chloro-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| InChIKey | ASCOLXHIXNBOGE-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)N(C(=O)N1)NC(=O)CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)