CAS 75020-42-7 is the registry number for Ethyl 5–chloro–1–((4–methoxyphenyl)methyl)–1H–1,2,3–triazole–4–carboxylate. Offered by: GLPBio. Available pack sizes: 250mg.
Ethyl 5-chloro-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (CAS 75020-42-7) is a chemical compound with the molecular formula C13H14ClN3O3 and a molecular weight of 295.72 g/mol. IUPAC name: ethyl 5-chloro-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate. InChIKey: PPXMGQIZAQMDDC-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O3 |
|---|---|
| Molecular weight | 295.72 g/mol |
| IUPAC name | ethyl 5-chloro-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| InChIKey | PPXMGQIZAQMDDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=N1)CC2=CC=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)