Products 2893755-25-2
CAS 2893755-25-2 is the registry number for 1,3-Di-tert-butylimidazolium Hydrogencarbonate (contains varying amounts of 1,3-Di-tert-butylimidazolium-2-carboxylate), >98.0%(HPLC). Offered by: TCI. Available pack sizes: 1g.
1,3-ditert-butylimidazol-1-ium;hydrogen carbonate (CAS 2893755-25-2) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: 1,3-ditert-butylimidazol-1-ium;hydrogen carbonate. InChIKey: HBWRMHHOGLEDRG-UHFFFAOYSA-M.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 1,3-ditert-butylimidazol-1-ium;hydrogen carbonate |
| InChIKey | HBWRMHHOGLEDRG-UHFFFAOYSA-M |
| SMILES | CC(C)(C)N1C=C[N+](=C1)C(C)(C)C.C(=O)(O)[O-] |
Computed by PubChem (NCBI)